C14H14N2O4S2 — CID 34145619
N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 34145619) has the molecular formula C14H14N2O4S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 34145619 |
| Molecular Formula | C14H14N2O4S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-[(1R)-1-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1cccs1)c1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C14H14N2O4S2/c1-9(16-22(18,19)14-3-2-6-21-14)10-4-5-12-11(7-10)15-13(17)8-20-12/h2-7,9,16H,8H2,1H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | UMWHCQGJSWJYRC-SECBINFHSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |