C26H24N2O2 — CID 3898421
N-(4-ethoxyphenyl)-6-ethyl-2-phenylquinoline-4-carboxamide (PubChem CID 3898421) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-6-ethyl-2-phenylquinoline-4-carboxamide.
| Compound Name | N-(4-ethoxyphenyl)-6-ethyl-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 3898421 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(4-ethoxyphenyl)-6-ethyl-2-phenylquinoline-4-carboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cc(-c3ccccc3)nc3ccc(CC)cc23)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-3-18-10-15-24-22(16-18)23(17-25(28-24)19-8-6-5-7-9-19)26(29)27-20-11-13-21(14-12-20)30-4-2/h5-17H,3-4H2,1-2H3,(H,27,29) |
| InChIKey | UQNGNQPHQVPHHZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |