About methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate
methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 38986062) has the molecular formula C17H13FN2O3S2
and a molecular weight of 376.43 g/mol. Its IUPAC name is methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
| PubChem CID | 38986062 |
| Molecular Formula | C17H13FN2O3S2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(NC(=O)c2ccc(-c3ccc(F)cc3)s2)n1 |
| InChI | InChI=1S/C17H13FN2O3S2/c1-23-15(21)8-12-9-24-17(19-12)20-16(22)14-7-6-13(25-14)10-2-4-11(18)5-3-10/h2-7,9H,8H2,1H3,(H,19,20,22) |
| InChIKey | YPXVNPMGURGBQA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate?
The IUPAC name of methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate (CID 38986062) is methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate?
The canonical SMILES for methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate is COC(=O)Cc1csc(NC(=O)c2ccc(-c3ccc(F)cc3)s2)n1.
What is the InChIKey of methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate?
The InChIKey is YPXVNPMGURGBQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13FN2O3S2/c1-23-15(21)8-12-9-24-17(19-12)20-16(22)14-7-6-13(25-14)10-2-4-11(18)5-3-10/h2-7,9H,8H2,1H3,(H,19,20,22).
What are the key properties of methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate?
methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate has a molecular weight of 376.43 g/mol, XLogP of 3.98, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 38986062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).