C35H27N5O2S — CID 3898665
4'-(2,5-dimethylphenyl)-3-(4-nitrophenyl)-2',5-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] (PubChem CID 3898665) has the molecular formula C35H27N5O2S and a molecular weight of 581.70 g/mol. Its IUPAC name is 4'-(2,5-dimethylphenyl)-3-(4-nitrophenyl)-2',5-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine].
| Compound Name | 4'-(2,5-dimethylphenyl)-3-(4-nitrophenyl)-2',5-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
|---|---|
| PubChem CID | 3898665 |
| Molecular Formula | C35H27N5O2S |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 4'-(2,5-dimethylphenyl)-3-(4-nitrophenyl)-2',5-diphenylspiro[1,3,4-thiadiazole-2,1'-phthalazine] |
| SMILES | Cc1ccc(C)c(C2=NN(c3ccccc3)C3(SC(c4ccccc4)=NN3c3ccc([N+](=O)[O-])cc3)c3ccccc32)c1 |
| InChI | InChI=1S/C35H27N5O2S/c1-24-17-18-25(2)31(23-24)33-30-15-9-10-16-32(30)35(38(36-33)27-13-7-4-8-14-27)39(28-19-21-29(22-20-28)40(41)42)37-34(43-35)26-11-5-3-6-12-26/h3-23H,1-2H3 |
| InChIKey | XYVIVOCDTMZBEJ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 74.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|