About [(3R)-3,7-dimethyloct-6-enyl] formate
[(3R)-3,7-dimethyloct-6-enyl] formate (PubChem CID 38989047) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is [(3R)-3,7-dimethyloct-6-enyl] formate.
Molecular Properties
| Compound Name | [(3R)-3,7-dimethyloct-6-enyl] formate |
| PubChem CID | 38989047 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | [(3R)-3,7-dimethyloct-6-enyl] formate |
| SMILES | CC(C)=CCC[C@@H](C)CCOC=O |
| InChI | InChI=1S/C11H20O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,9,11H,4,6-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | DZNVIZQPWLDQHI-LLVKDONJSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-3,7-dimethyloct-6-enyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3,7-dimethyloct-6-enyl] formate?
The IUPAC name of [(3R)-3,7-dimethyloct-6-enyl] formate (CID 38989047) is [(3R)-3,7-dimethyloct-6-enyl] formate.
What is the SMILES notation for [(3R)-3,7-dimethyloct-6-enyl] formate?
The canonical SMILES for [(3R)-3,7-dimethyloct-6-enyl] formate is CC(C)=CCC[C@@H](C)CCOC=O.
What is the InChIKey of [(3R)-3,7-dimethyloct-6-enyl] formate?
The InChIKey is DZNVIZQPWLDQHI-LLVKDONJSA-N. The full InChI is InChI=1S/C11H20O2/c1-10(2)5-4-6-11(3)7-8-13-9-12/h5,9,11H,4,6-8H2,1-3H3/t11-/m1/s1.
What are the key properties of [(3R)-3,7-dimethyloct-6-enyl] formate?
[(3R)-3,7-dimethyloct-6-enyl] formate has a molecular weight of 184.28 g/mol, XLogP of 2.93, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3,7-dimethyloct-6-enyl] formate is sourced from PubChem (CID 38989047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).