C20H21Cl2N3O3 — CID 38993001
N-[2-[[(3S)-3-benzamidobutanoyl]amino]ethyl]-3,4-dichlorobenzamide (PubChem CID 38993001) has the molecular formula C20H21Cl2N3O3 and a molecular weight of 422.31 g/mol. Its IUPAC name is N-[2-[[(3S)-3-benzamidobutanoyl]amino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[[(3S)-3-benzamidobutanoyl]amino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 38993001 |
| Molecular Formula | C20H21Cl2N3O3 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-[2-[[(3S)-3-benzamidobutanoyl]amino]ethyl]-3,4-dichlorobenzamide |
| SMILES | C[C@@H](CC(=O)NCCNC(=O)c1ccc(Cl)c(Cl)c1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21Cl2N3O3/c1-13(25-20(28)14-5-3-2-4-6-14)11-18(26)23-9-10-24-19(27)15-7-8-16(21)17(22)12-15/h2-8,12-13H,9-11H2,1H3,(H,23,26)(H,24,27)(H,25,28)/t13-/m0/s1 |
| InChIKey | CSSUJVQWZIAMSX-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|