C16H19Cl2N3O — CID 38996990
N-[2-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]hexanamide (PubChem CID 38996990) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is N-[2-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]hexanamide.
| Compound Name | N-[2-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]hexanamide |
|---|---|
| PubChem CID | 38996990 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-[(2,6-dichlorophenyl)methyl]pyrazol-3-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccnn1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H19Cl2N3O/c1-2-3-4-8-16(22)20-15-9-10-19-21(15)11-12-13(17)6-5-7-14(12)18/h5-7,9-10H,2-4,8,11H2,1H3,(H,20,22) |
| InChIKey | HZRVPKRLUYRALW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|