C22H21NO5 — CID 39035714
methyl (E)-3-[3-methoxy-4-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]prop-2-enoate (PubChem CID 39035714) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is methyl (E)-3-[3-methoxy-4-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-methoxy-4-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 39035714 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | methyl (E)-3-[3-methoxy-4-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methoxy]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(OCc2coc(-c3ccc(C)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C22H21NO5/c1-15-4-8-17(9-5-15)22-23-18(14-28-22)13-27-19-10-6-16(12-20(19)25-2)7-11-21(24)26-3/h4-12,14H,13H2,1-3H3/b11-7+ |
| InChIKey | WXXGXMZDZGMWLC-YRNVUSSQSA-N |
| XLogP | 4.42 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|