C19H19N3O5S — CID 39040573
2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 39040573) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 39040573 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-[5-[(2S)-oxolan-2-yl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1c(C)c2ccc(OCC(=O)Nc3nnc([C@@H]4CCCO4)s3)cc2oc1=O |
| InChI | InChI=1S/C19H19N3O5S/c1-10-11(2)18(24)27-15-8-12(5-6-13(10)15)26-9-16(23)20-19-22-21-17(28-19)14-4-3-7-25-14/h5-6,8,14H,3-4,7,9H2,1-2H3,(H,20,22,23)/t14-/m0/s1 |
| InChIKey | CFTRYXJYDYLWCA-AWEZNQCLSA-N |
| XLogP | 3.13 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|