C18H26N4O3S — CID 39045690
1-ethyl-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-3-propan-2-ylpyrazole-5-carboxamide (PubChem CID 39045690) has the molecular formula C18H26N4O3S and a molecular weight of 378.50 g/mol. Its IUPAC name is 1-ethyl-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-3-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-3-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 39045690 |
| Molecular Formula | C18H26N4O3S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-ethyl-N-[[2-(methylsulfamoylmethyl)phenyl]methyl]-3-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CCn1nc(C(C)C)cc1C(=O)NCc1ccccc1CS(=O)(=O)NC |
| InChI | InChI=1S/C18H26N4O3S/c1-5-22-17(10-16(21-22)13(2)3)18(23)20-11-14-8-6-7-9-15(14)12-26(24,25)19-4/h6-10,13,19H,5,11-12H2,1-4H3,(H,20,23) |
| InChIKey | BTQDNPKURAGSDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |