C23H37N5O — CID 3905636
2-tert-butyl-N-[3-(2-methylpiperidin-1-yl)propyl]-7-propan-2-ylpyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 3905636) has the molecular formula C23H37N5O and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-tert-butyl-N-[3-(2-methylpiperidin-1-yl)propyl]-7-propan-2-ylpyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-tert-butyl-N-[3-(2-methylpiperidin-1-yl)propyl]-7-propan-2-ylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 3905636 |
| Molecular Formula | C23H37N5O |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 2-tert-butyl-N-[3-(2-methylpiperidin-1-yl)propyl]-7-propan-2-ylpyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC(C)c1c(C(=O)NCCCN2CCCCC2C)cnc2cc(C(C)(C)C)nn12 |
| InChI | InChI=1S/C23H37N5O/c1-16(2)21-18(15-25-20-14-19(23(4,5)6)26-28(20)21)22(29)24-11-9-13-27-12-8-7-10-17(27)3/h14-17H,7-13H2,1-6H3,(H,24,29) |
| InChIKey | MCNFMZPBGUNFHN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|