C22H35N5O — CID 4236035
2-tert-butyl-7-ethyl-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 4236035) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-tert-butyl-7-ethyl-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-tert-butyl-7-ethyl-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4236035 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | 2-tert-butyl-7-ethyl-N-[3-(2-methylpiperidin-1-yl)propyl]pyrazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCc1c(C(=O)NCCCN2CCCCC2C)cnc2cc(C(C)(C)C)nn12 |
| InChI | InChI=1S/C22H35N5O/c1-6-18-17(15-24-20-14-19(22(3,4)5)25-27(18)20)21(28)23-11-9-13-26-12-8-7-10-16(26)2/h14-16H,6-13H2,1-5H3,(H,23,28) |
| InChIKey | MKFJPSGZIQJIEB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|