C12H11N3O7 — CID 39067993
2-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]acetic acid (PubChem CID 39067993) has the molecular formula C12H11N3O7 and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]acetic acid.
| Compound Name | 2-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 39067993 |
| Molecular Formula | C12H11N3O7 |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[[2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CN1CC(=O)Oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H11N3O7/c16-10(13-4-11(17)18)5-14-6-12(19)22-9-3-7(15(20)21)1-2-8(9)14/h1-3H,4-6H2,(H,13,16)(H,17,18) |
| InChIKey | GRRSXMKFMPXUSH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|