C22H25N3O4 — CID 39068783
4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-3H-1,4-benzoxazin-2-one (PubChem CID 39068783) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-3H-1,4-benzoxazin-2-one.
| Compound Name | 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 39068783 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-[2-[4-(2-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-6-methyl-3H-1,4-benzoxazin-2-one |
| SMILES | COc1ccccc1N1CCN(C(=O)CN2CC(=O)Oc3ccc(C)cc32)CC1 |
| InChI | InChI=1S/C22H25N3O4/c1-16-7-8-20-18(13-16)25(15-22(27)29-20)14-21(26)24-11-9-23(10-12-24)17-5-3-4-6-19(17)28-2/h3-8,13H,9-12,14-15H2,1-2H3 |
| InChIKey | KIXXNPHJARLQGP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|