C19H21N5O3 — CID 39068799
6-methyl-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3H-1,4-benzoxazin-2-one (PubChem CID 39068799) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-methyl-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3H-1,4-benzoxazin-2-one.
| Compound Name | 6-methyl-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 39068799 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 6-methyl-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]-3H-1,4-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)N(CC(=O)N1CCN(c3ncccn3)CC1)CC(=O)O2 |
| InChI | InChI=1S/C19H21N5O3/c1-14-3-4-16-15(11-14)24(13-18(26)27-16)12-17(25)22-7-9-23(10-8-22)19-20-5-2-6-21-19/h2-6,11H,7-10,12-13H2,1H3 |
| InChIKey | UYVQWKCCGSJHSJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|