C17H20N2O5 — CID 39068831
1-[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxylic acid (PubChem CID 39068831) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 1-[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 39068831 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[2-(6-methyl-2-oxo-3H-1,4-benzoxazin-4-yl)acetyl]piperidine-4-carboxylic acid |
| SMILES | Cc1ccc2c(c1)N(CC(=O)N1CCC(C(=O)O)CC1)CC(=O)O2 |
| InChI | InChI=1S/C17H20N2O5/c1-11-2-3-14-13(8-11)19(10-16(21)24-14)9-15(20)18-6-4-12(5-7-18)17(22)23/h2-3,8,12H,4-7,9-10H2,1H3,(H,22,23) |
| InChIKey | ASNUKNVBYFQDPI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|