C18H18N4O5 — CID 39069406
N-methyl-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 39069406) has the molecular formula C18H18N4O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is N-methyl-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | N-methyl-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 39069406 |
| Molecular Formula | C18H18N4O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-methyl-2-(7-nitro-2-oxo-3H-1,4-benzoxazin-4-yl)-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | CN(CCc1ccncc1)C(=O)CN1CC(=O)Oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H18N4O5/c1-20(9-6-13-4-7-19-8-5-13)17(23)11-21-12-18(24)27-16-10-14(22(25)26)2-3-15(16)21/h2-5,7-8,10H,6,9,11-12H2,1H3 |
| InChIKey | VJXXDPSABBKDGT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|