C17H22N2O5S — CID 39069574
7-ethylsulfonyl-4-(2-oxo-2-piperidin-1-ylethyl)-3H-1,4-benzoxazin-2-one (PubChem CID 39069574) has the molecular formula C17H22N2O5S and a molecular weight of 366.44 g/mol. Its IUPAC name is 7-ethylsulfonyl-4-(2-oxo-2-piperidin-1-ylethyl)-3H-1,4-benzoxazin-2-one.
| Compound Name | 7-ethylsulfonyl-4-(2-oxo-2-piperidin-1-ylethyl)-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 39069574 |
| Molecular Formula | C17H22N2O5S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 7-ethylsulfonyl-4-(2-oxo-2-piperidin-1-ylethyl)-3H-1,4-benzoxazin-2-one |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)OC(=O)CN2CC(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H22N2O5S/c1-2-25(22,23)13-6-7-14-15(10-13)24-17(21)12-19(14)11-16(20)18-8-4-3-5-9-18/h6-7,10H,2-5,8-9,11-12H2,1H3 |
| InChIKey | PYYAXYHJVQMLHB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|