C19H19N3O5 — CID 39068775
4-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3H-1,4-benzoxazin-2-one (PubChem CID 39068775) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is 4-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3H-1,4-benzoxazin-2-one.
| Compound Name | 4-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 39068775 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 4-[2-[4-(furan-2-carbonyl)piperazin-1-yl]-2-oxoethyl]-3H-1,4-benzoxazin-2-one |
| SMILES | O=C1CN(CC(=O)N2CCN(C(=O)c3ccco3)CC2)c2ccccc2O1 |
| InChI | InChI=1S/C19H19N3O5/c23-17(12-22-13-18(24)27-15-5-2-1-4-14(15)22)20-7-9-21(10-8-20)19(25)16-6-3-11-26-16/h1-6,11H,7-10,12-13H2 |
| InChIKey | YLGMDXGYZMCZAI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|