C20H22F3N5 — CID 3907052
N-[2-[1-(2-ethyl-6-methylphenyl)tetrazol-5-yl]propan-2-yl]-3-(trifluoromethyl)aniline (PubChem CID 3907052) has the molecular formula C20H22F3N5 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[2-[1-(2-ethyl-6-methylphenyl)tetrazol-5-yl]propan-2-yl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[2-[1-(2-ethyl-6-methylphenyl)tetrazol-5-yl]propan-2-yl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3907052 |
| Molecular Formula | C20H22F3N5 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[2-[1-(2-ethyl-6-methylphenyl)tetrazol-5-yl]propan-2-yl]-3-(trifluoromethyl)aniline |
| SMILES | CCc1cccc(C)c1-n1nnnc1C(C)(C)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F3N5/c1-5-14-9-6-8-13(2)17(14)28-18(25-26-27-28)19(3,4)24-16-11-7-10-15(12-16)20(21,22)23/h6-12,24H,5H2,1-4H3 |
| InChIKey | WCJXIMKMYHQMEJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |