C19H20F3N5O — CID 94086700
4-methoxy-N-[(2S)-2-[1-[3-(trifluoromethyl)phenyl]tetrazol-5-yl]butan-2-yl]aniline (PubChem CID 94086700) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-2-[1-[3-(trifluoromethyl)phenyl]tetrazol-5-yl]butan-2-yl]aniline.
| Compound Name | 4-methoxy-N-[(2S)-2-[1-[3-(trifluoromethyl)phenyl]tetrazol-5-yl]butan-2-yl]aniline |
|---|---|
| PubChem CID | 94086700 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-methoxy-N-[(2S)-2-[1-[3-(trifluoromethyl)phenyl]tetrazol-5-yl]butan-2-yl]aniline |
| SMILES | CC[C@](C)(Nc1ccc(OC)cc1)c1nnnn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H20F3N5O/c1-4-18(2,23-14-8-10-16(28-3)11-9-14)17-24-25-26-27(17)15-7-5-6-13(12-15)19(20,21)22/h5-12,23H,4H2,1-3H3/t18-/m0/s1 |
| InChIKey | CBKWXWRVLAGCOC-SFHVURJKSA-N |
| XLogP | 4.43 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|