C19H21N5O2 — CID 94086664
N-[(2R)-2-(1-phenyltetrazol-5-yl)butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 94086664) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[(2R)-2-(1-phenyltetrazol-5-yl)butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(2R)-2-(1-phenyltetrazol-5-yl)butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 94086664 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[(2R)-2-(1-phenyltetrazol-5-yl)butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC[C@@](C)(Nc1ccc2c(c1)OCCO2)c1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-19(2,18-21-22-23-24(18)15-7-5-4-6-8-15)20-14-9-10-16-17(13-14)26-12-11-25-16/h4-10,13,20H,3,11-12H2,1-2H3/t19-/m1/s1 |
| InChIKey | DNNBPKGEJBHOEN-LJQANCHMSA-N |
| XLogP | 3.17 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|