C20H23N5O3 — CID 94086671
N-[(2S)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 94086671) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[(2S)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(2S)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 94086671 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[(2S)-2-[1-(4-methoxyphenyl)tetrazol-5-yl]butan-2-yl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | CC[C@](C)(Nc1ccc2c(c1)OCCO2)c1nnnn1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-4-20(2,21-14-5-10-17-18(13-14)28-12-11-27-17)19-22-23-24-25(19)15-6-8-16(26-3)9-7-15/h5-10,13,21H,4,11-12H2,1-3H3/t20-/m0/s1 |
| InChIKey | KABIPWXBUPEXDV-FQEVSTJZSA-N |
| XLogP | 3.18 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|