C26H33N5O6 — CID 70698518
6-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]-6-[2-(3,4-dimethoxyphenyl)ethylamino]heptanoic acid (PubChem CID 70698518) has the molecular formula C26H33N5O6 and a molecular weight of 511.58 g/mol. Its IUPAC name is 6-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]-6-[2-(3,4-dimethoxyphenyl)ethylamino]heptanoic acid.
| Compound Name | 6-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]-6-[2-(3,4-dimethoxyphenyl)ethylamino]heptanoic acid |
|---|---|
| PubChem CID | 70698518 |
| Molecular Formula | C26H33N5O6 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 6-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)tetrazol-5-yl]-6-[2-(3,4-dimethoxyphenyl)ethylamino]heptanoic acid |
| SMILES | COc1ccc(CCNC(C)(CCCCC(=O)O)c2nnnn2-c2ccc3c(c2)OCCO3)cc1OC |
| InChI | InChI=1S/C26H33N5O6/c1-26(12-5-4-6-24(32)33,27-13-11-18-7-9-20(34-2)22(16-18)35-3)25-28-29-30-31(25)19-8-10-21-23(17-19)37-15-14-36-21/h7-10,16-17,27H,4-6,11-15H2,1-3H3,(H,32,33) |
| InChIKey | BQOLQXJIKKCAFO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|