C19H20F3N5 — CID 94086714
N-[(2S)-2-[1-(4-methylphenyl)tetrazol-5-yl]butan-2-yl]-3-(trifluoromethyl)aniline (PubChem CID 94086714) has the molecular formula C19H20F3N5 and a molecular weight of 375.40 g/mol. Its IUPAC name is N-[(2S)-2-[1-(4-methylphenyl)tetrazol-5-yl]butan-2-yl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[(2S)-2-[1-(4-methylphenyl)tetrazol-5-yl]butan-2-yl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 94086714 |
| Molecular Formula | C19H20F3N5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[(2S)-2-[1-(4-methylphenyl)tetrazol-5-yl]butan-2-yl]-3-(trifluoromethyl)aniline |
| SMILES | CC[C@](C)(Nc1cccc(C(F)(F)F)c1)c1nnnn1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20F3N5/c1-4-18(3,23-15-7-5-6-14(12-15)19(20,21)22)17-24-25-26-27(17)16-10-8-13(2)9-11-16/h5-12,23H,4H2,1-3H3/t18-/m0/s1 |
| InChIKey | INJFUPUVVJICAT-SFHVURJKSA-N |
| XLogP | 4.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |