C21H27N5O — CID 3559515
N-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-4-ethoxyaniline (PubChem CID 3559515) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-4-ethoxyaniline.
| Compound Name | N-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-4-ethoxyaniline |
|---|---|
| PubChem CID | 3559515 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | N-[2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-4-ethoxyaniline |
| SMILES | CCOc1ccc(NC(C)(CC)c2nnnn2-c2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C21H27N5O/c1-6-21(5,22-17-11-13-18(14-12-17)27-7-2)20-23-24-25-26(20)19-15(3)9-8-10-16(19)4/h8-14,22H,6-7H2,1-5H3 |
| InChIKey | RDMXOOBZZQUUTL-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|