C19H22N6O — CID 7335945
N-[(2R)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-N-phenylnitrous amide (PubChem CID 7335945) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[(2R)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-N-phenylnitrous amide.
| Compound Name | N-[(2R)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-N-phenylnitrous amide |
|---|---|
| PubChem CID | 7335945 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N-[(2R)-2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]butan-2-yl]-N-phenylnitrous amide |
| SMILES | CC[C@](C)(c1nnnn1-c1c(C)cccc1C)N(N=O)c1ccccc1 |
| InChI | InChI=1S/C19H22N6O/c1-5-19(4,25(23-26)16-12-7-6-8-13-16)18-20-21-22-24(18)17-14(2)10-9-11-15(17)3/h6-13H,5H2,1-4H3/t19-/m1/s1 |
| InChIKey | BRPNLWHJOYRPDW-LJQANCHMSA-N |
| XLogP | 4.09 |
| TPSA | 76.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|