C20H16FN3O2S — CID 39073454
N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-3-fluorobenzamide (PubChem CID 39073454) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-3-fluorobenzamide.
| Compound Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 39073454 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-3-fluorobenzamide |
| SMILES | CC(=O)N1CCc2ccc(-c3csc(NC(=O)c4cccc(F)c4)n3)cc21 |
| InChI | InChI=1S/C20H16FN3O2S/c1-12(25)24-8-7-13-5-6-14(10-18(13)24)17-11-27-20(22-17)23-19(26)15-3-2-4-16(21)9-15/h2-6,9-11H,7-8H2,1H3,(H,22,23,26) |
| InChIKey | LFWUVNBMVYGPMV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |