C20H14F3N3O2S — CID 39073636
N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2,3,4-trifluorobenzamide (PubChem CID 39073636) has the molecular formula C20H14F3N3O2S and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 39073636 |
| Molecular Formula | C20H14F3N3O2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2,3,4-trifluorobenzamide |
| SMILES | CC(=O)N1CCc2ccc(-c3csc(NC(=O)c4ccc(F)c(F)c4F)n3)cc21 |
| InChI | InChI=1S/C20H14F3N3O2S/c1-10(27)26-7-6-11-2-3-12(8-16(11)26)15-9-29-20(24-15)25-19(28)13-4-5-14(21)18(23)17(13)22/h2-5,8-9H,6-7H2,1H3,(H,24,25,28) |
| InChIKey | GVWSSXLTAVTEPQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|