C21H19N3O3S — CID 39073463
N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2-methoxybenzamide (PubChem CID 39073463) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2-methoxybenzamide.
| Compound Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 39073463 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[4-(1-acetyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1nc(-c2ccc3c(c2)N(C(C)=O)CC3)cs1 |
| InChI | InChI=1S/C21H19N3O3S/c1-13(25)24-10-9-14-7-8-15(11-18(14)24)17-12-28-21(22-17)23-20(26)16-5-3-4-6-19(16)27-2/h3-8,11-12H,9-10H2,1-2H3,(H,22,23,26) |
| InChIKey | UWYYEXPPXUKJGG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |