C17H17N3O2S — CID 39084664
N-benzyl-2,3,5-trimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 39084664) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-benzyl-2,3,5-trimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-benzyl-2,3,5-trimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 39084664 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-benzyl-2,3,5-trimethyl-4-oxothieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccccc2)sc2nc(C)n(C)c(=O)c12 |
| InChI | InChI=1S/C17H17N3O2S/c1-10-13-16(19-11(2)20(3)17(13)22)23-14(10)15(21)18-9-12-7-5-4-6-8-12/h4-8H,9H2,1-3H3,(H,18,21) |
| InChIKey | RPRHGHMFMVSORR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |