C20H29NO3 — CID 39102730
(E)-3-[2-[2-[hexyl(prop-2-enyl)amino]ethoxy]phenyl]prop-2-enoic acid (PubChem CID 39102730) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (E)-3-[2-[2-[hexyl(prop-2-enyl)amino]ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-[hexyl(prop-2-enyl)amino]ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39102730 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (E)-3-[2-[2-[hexyl(prop-2-enyl)amino]ethoxy]phenyl]prop-2-enoic acid |
| SMILES | C=CCN(CCCCCC)CCOc1ccccc1/C=C/C(=O)O |
| InChI | InChI=1S/C20H29NO3/c1-3-5-6-9-15-21(14-4-2)16-17-24-19-11-8-7-10-18(19)12-13-20(22)23/h4,7-8,10-13H,2-3,5-6,9,14-17H2,1H3,(H,22,23)/b13-12+ |
| InChIKey | ZKZWLZAYAOLEPU-OUKQBFOZSA-N |
| XLogP | 4.23 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|