C13H14Cl2N2OS — CID 3910621
2-[4-(3,5-dichloro-2-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 3910621) has the molecular formula C13H14Cl2N2OS and a molecular weight of 317.24 g/mol. Its IUPAC name is 2-[4-(3,5-dichloro-2-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 2-[4-(3,5-dichloro-2-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 3910621 |
| Molecular Formula | C13H14Cl2N2OS |
| Molecular Weight | 317.24 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-[4-(3,5-dichloro-2-ethoxyphenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | CCOc1c(Cl)cc(Cl)cc1-c1csc(CCN)n1 |
| InChI | InChI=1S/C13H14Cl2N2OS/c1-2-18-13-9(5-8(14)6-10(13)15)11-7-19-12(17-11)3-4-16/h5-7H,2-4,16H2,1H3 |
| InChIKey | YYPTVCZSOKOIMD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |