C17H26N4O — CID 39112878
3-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]-N-cyclopropylpropanamide (PubChem CID 39112878) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]-N-cyclopropylpropanamide.
| Compound Name | 3-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 39112878 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3-[3-amino-4-(4-methylpiperazin-1-yl)phenyl]-N-cyclopropylpropanamide |
| SMILES | CN1CCN(c2ccc(CCC(=O)NC3CC3)cc2N)CC1 |
| InChI | InChI=1S/C17H26N4O/c1-20-8-10-21(11-9-20)16-6-2-13(12-15(16)18)3-7-17(22)19-14-4-5-14/h2,6,12,14H,3-5,7-11,18H2,1H3,(H,19,22) |
| InChIKey | WLNJNSKQMCUOQN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|