C27H19FN4O5 — CID 3915661
11-(4-fluorobenzoyl)-14-(2-methyl-5-nitrophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 3915661) has the molecular formula C27H19FN4O5 and a molecular weight of 498.47 g/mol. Its IUPAC name is 11-(4-fluorobenzoyl)-14-(2-methyl-5-nitrophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | 11-(4-fluorobenzoyl)-14-(2-methyl-5-nitrophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 3915661 |
| Molecular Formula | C27H19FN4O5 |
| Molecular Weight | 498.47 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 11-(4-fluorobenzoyl)-14-(2-methyl-5-nitrophenyl)-9,10,14-triazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(=O)C2C(C1=O)C1c3ccccc3C=NN1C2C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H19FN4O5/c1-14-6-11-18(32(36)37)12-20(14)30-26(34)21-22(27(30)35)24(25(33)15-7-9-17(28)10-8-15)31-23(21)19-5-3-2-4-16(19)13-29-31/h2-13,21-24H,1H3 |
| InChIKey | FIJHVXBCEJWKML-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 113.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|