C16H14N4O2 — CID 39158040
2-(5,6-dimethoxy-2-pyridin-3-ylbenzimidazol-1-yl)acetonitrile (PubChem CID 39158040) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(5,6-dimethoxy-2-pyridin-3-ylbenzimidazol-1-yl)acetonitrile.
| Compound Name | 2-(5,6-dimethoxy-2-pyridin-3-ylbenzimidazol-1-yl)acetonitrile |
|---|---|
| PubChem CID | 39158040 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(5,6-dimethoxy-2-pyridin-3-ylbenzimidazol-1-yl)acetonitrile |
| SMILES | COc1cc2nc(-c3cccnc3)n(CC#N)c2cc1OC |
| InChI | InChI=1S/C16H14N4O2/c1-21-14-8-12-13(9-15(14)22-2)20(7-5-17)16(19-12)11-4-3-6-18-10-11/h3-4,6,8-10H,7H2,1-2H3 |
| InChIKey | NADWEZLOQZFLKK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |