C17H17N3OS2 — CID 39158780
2-[5-(2,4-dimethylphenyl)-2-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide (PubChem CID 39158780) has the molecular formula C17H17N3OS2 and a molecular weight of 343.48 g/mol. Its IUPAC name is 2-[5-(2,4-dimethylphenyl)-2-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide.
| Compound Name | 2-[5-(2,4-dimethylphenyl)-2-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 39158780 |
| Molecular Formula | C17H17N3OS2 |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-[5-(2,4-dimethylphenyl)-2-methyl-4-oxothieno[2,3-d]pyrimidin-3-yl]ethanethioamide |
| SMILES | Cc1ccc(-c2csc3nc(C)n(CC(N)=S)c(=O)c23)c(C)c1 |
| InChI | InChI=1S/C17H17N3OS2/c1-9-4-5-12(10(2)6-9)13-8-23-16-15(13)17(21)20(7-14(18)22)11(3)19-16/h4-6,8H,7H2,1-3H3,(H2,18,22) |
| InChIKey | UALKEDGJMFBMEI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|