C25H23N3OS — CID 110832802
4-[2-benzyl-5-(2,4-dimethylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanenitrile (PubChem CID 110832802) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 4-[2-benzyl-5-(2,4-dimethylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanenitrile.
| Compound Name | 4-[2-benzyl-5-(2,4-dimethylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanenitrile |
|---|---|
| PubChem CID | 110832802 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-[2-benzyl-5-(2,4-dimethylphenyl)-4-oxothieno[2,3-d]pyrimidin-3-yl]butanenitrile |
| SMILES | Cc1ccc(-c2csc3nc(Cc4ccccc4)n(CCCC#N)c(=O)c23)c(C)c1 |
| InChI | InChI=1S/C25H23N3OS/c1-17-10-11-20(18(2)14-17)21-16-30-24-23(21)25(29)28(13-7-6-12-26)22(27-24)15-19-8-4-3-5-9-19/h3-5,8-11,14,16H,6-7,13,15H2,1-2H3 |
| InChIKey | NUIAZWIGGDWPJA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|