C16H13N3OS2 — CID 39159321
2-(16-oxo-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13-hexaen-15-yl)ethanethioamide (PubChem CID 39159321) has the molecular formula C16H13N3OS2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-(16-oxo-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13-hexaen-15-yl)ethanethioamide.
| Compound Name | 2-(16-oxo-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13-hexaen-15-yl)ethanethioamide |
|---|---|
| PubChem CID | 39159321 |
| Molecular Formula | C16H13N3OS2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 2-(16-oxo-11-thia-13,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,12(17),13-hexaen-15-yl)ethanethioamide |
| SMILES | NC(=S)Cn1cnc2sc3c(c2c1=O)-c1ccccc1CC3 |
| InChI | InChI=1S/C16H13N3OS2/c17-12(21)7-19-8-18-15-14(16(19)20)13-10-4-2-1-3-9(10)5-6-11(13)22-15/h1-4,8H,5-7H2,(H2,17,21) |
| InChIKey | YPPUGOFELCKUBO-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|