C16H15N3S3 — CID 39159407
2-[2-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylethanethioamide (PubChem CID 39159407) has the molecular formula C16H15N3S3 and a molecular weight of 345.52 g/mol. Its IUPAC name is 2-[2-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylethanethioamide.
| Compound Name | 2-[2-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylethanethioamide |
|---|---|
| PubChem CID | 39159407 |
| Molecular Formula | C16H15N3S3 |
| Molecular Weight | 345.52 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 2-[2-methyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-yl]sulfanylethanethioamide |
| SMILES | Cc1ccc(-c2csc3nc(C)nc(SCC(N)=S)c23)cc1 |
| InChI | InChI=1S/C16H15N3S3/c1-9-3-5-11(6-4-9)12-7-21-15-14(12)16(19-10(2)18-15)22-8-13(17)20/h3-7H,8H2,1-2H3,(H2,17,20) |
| InChIKey | YZZAARZNSSTIGK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|