C13H10N2O3 — CID 39163493
(2E)-5-amino-2-(furan-2-ylmethylidene)-4H-1,4-benzoxazin-3-one (PubChem CID 39163493) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is (2E)-5-amino-2-(furan-2-ylmethylidene)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2E)-5-amino-2-(furan-2-ylmethylidene)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 39163493 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2E)-5-amino-2-(furan-2-ylmethylidene)-4H-1,4-benzoxazin-3-one |
| SMILES | Nc1cccc2c1NC(=O)/C(=C\c1ccco1)O2 |
| InChI | InChI=1S/C13H10N2O3/c14-9-4-1-5-10-12(9)15-13(16)11(18-10)7-8-3-2-6-17-8/h1-7H,14H2,(H,15,16)/b11-7+ |
| InChIKey | PPLUJUZCRTVGGM-YRNVUSSQSA-N |
| XLogP | 2.23 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|