C10H12N2O2 — CID 115095841
5-amino-3,3-dimethyl-4H-1,4-benzoxazin-2-one (PubChem CID 115095841) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-amino-3,3-dimethyl-4H-1,4-benzoxazin-2-one.
| Compound Name | 5-amino-3,3-dimethyl-4H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 115095841 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 5-amino-3,3-dimethyl-4H-1,4-benzoxazin-2-one |
| SMILES | CC1(C)Nc2c(N)cccc2OC1=O |
| InChI | InChI=1S/C10H12N2O2/c1-10(2)9(13)14-7-5-3-4-6(11)8(7)12-10/h3-5,12H,11H2,1-2H3 |
| InChIKey | RBGNHKCIYYMTPP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|