C10H11NO3 — CID 115094866
5-hydroxy-3,3-dimethyl-4H-1,4-benzoxazin-2-one (PubChem CID 115094866) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 5-hydroxy-3,3-dimethyl-4H-1,4-benzoxazin-2-one.
| Compound Name | 5-hydroxy-3,3-dimethyl-4H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 115094866 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 5-hydroxy-3,3-dimethyl-4H-1,4-benzoxazin-2-one |
| SMILES | CC1(C)Nc2c(O)cccc2OC1=O |
| InChI | InChI=1S/C10H11NO3/c1-10(2)9(13)14-7-5-3-4-6(12)8(7)11-10/h3-5,11-12H,1-2H3 |
| InChIKey | LRWYRBPXTDFDJT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|