C15H18N2O8S — CID 3916935
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 3916935) has the molecular formula C15H18N2O8S and a molecular weight of 386.38 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 3916935 |
| Molecular Formula | C15H18N2O8S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NCC2CCCO2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N2O8S/c1-26(22,23)13-5-4-10(7-12(13)17(20)21)15(19)25-9-14(18)16-8-11-3-2-6-24-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,16,18) |
| InChIKey | WHRMIACERZRUBG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|