C16H18N2O5 — CID 39194579
4-[[4-(2-methylprop-2-enyl)-3-oxo-1,4-benzoxazin-7-yl]amino]-4-oxobutanoic acid (PubChem CID 39194579) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-[[4-(2-methylprop-2-enyl)-3-oxo-1,4-benzoxazin-7-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-(2-methylprop-2-enyl)-3-oxo-1,4-benzoxazin-7-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39194579 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-[[4-(2-methylprop-2-enyl)-3-oxo-1,4-benzoxazin-7-yl]amino]-4-oxobutanoic acid |
| SMILES | C=C(C)CN1C(=O)COc2cc(NC(=O)CCC(=O)O)ccc21 |
| InChI | InChI=1S/C16H18N2O5/c1-10(2)8-18-12-4-3-11(7-13(12)23-9-15(18)20)17-14(19)5-6-16(21)22/h3-4,7H,1,5-6,8-9H2,2H3,(H,17,19)(H,21,22) |
| InChIKey | LYPIHNFWACJZDX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|