About 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid
3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid (PubChem CID 82310297) has the molecular formula C16H20N2O4
and a molecular weight of 304.35 g/mol. Its IUPAC name is 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid |
| PubChem CID | 82310297 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid |
| SMILES | C=C(C)CN(CCC(=O)O)c1ccc2c(c1)OCC(=O)N2C |
| InChI | InChI=1S/C16H20N2O4/c1-11(2)9-18(7-6-16(20)21)12-4-5-13-14(8-12)22-10-15(19)17(13)3/h4-5,8H,1,6-7,9-10H2,2-3H3,(H,20,21) |
| InChIKey | ZNLNKXGKELXVJS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid?
The IUPAC name of 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid (CID 82310297) is 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid.
What is the SMILES notation for 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid?
The canonical SMILES for 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid is C=C(C)CN(CCC(=O)O)c1ccc2c(c1)OCC(=O)N2C.
What is the InChIKey of 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid?
The InChIKey is ZNLNKXGKELXVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4/c1-11(2)9-18(7-6-16(20)21)12-4-5-13-14(8-12)22-10-15(19)17(13)3/h4-5,8H,1,6-7,9-10H2,2-3H3,(H,20,21).
What are the key properties of 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid?
3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid has a molecular weight of 304.35 g/mol, XLogP of 1.90, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methyl-3-oxo-1,4-benzoxazin-7-yl)-(2-methylprop-2-enyl)amino]propanoic acid is sourced from PubChem (CID 82310297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).