C17H24N2O4 — CID 95508326
3-[(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-(2-methylpropyl)amino]propanoic acid (PubChem CID 95508326) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-[(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 3-[(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 95508326 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3-[(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)-(2-methylpropyl)amino]propanoic acid |
| SMILES | CCN1C(=O)COc2ccc(N(CCC(=O)O)CC(C)C)cc21 |
| InChI | InChI=1S/C17H24N2O4/c1-4-19-14-9-13(5-6-15(14)23-11-16(19)20)18(10-12(2)3)8-7-17(21)22/h5-6,9,12H,4,7-8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | JCSBIGAXMMOTIR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|