C14H16ClNO4 — CID 82351978
3-chloro-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)butanoic acid (PubChem CID 82351978) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-chloro-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)butanoic acid.
| Compound Name | 3-chloro-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 82351978 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-chloro-4-(4-ethyl-3-oxo-1,4-benzoxazin-6-yl)butanoic acid |
| SMILES | CCN1C(=O)COc2ccc(CC(Cl)CC(=O)O)cc21 |
| InChI | InChI=1S/C14H16ClNO4/c1-2-16-11-6-9(5-10(15)7-14(18)19)3-4-12(11)20-8-13(16)17/h3-4,6,10H,2,5,7-8H2,1H3,(H,18,19) |
| InChIKey | UCAHJXOPQDMKLG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|