C13H12ClNO5 — CID 82019458
2-[6-(2-chloropropanoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 82019458) has the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. Its IUPAC name is 2-[6-(2-chloropropanoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[6-(2-chloropropanoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 82019458 |
| Molecular Formula | C13H12ClNO5 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[6-(2-chloropropanoyl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | CC(Cl)C(=O)c1ccc2c(c1)N(CC(=O)O)C(=O)CO2 |
| InChI | InChI=1S/C13H12ClNO5/c1-7(14)13(19)8-2-3-10-9(4-8)15(5-12(17)18)11(16)6-20-10/h2-4,7H,5-6H2,1H3,(H,17,18) |
| InChIKey | ARXSBPPSWREYSM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|