C17H25N3O2 — CID 82255594
4-ethyl-6-(2-piperazin-1-ylpropyl)-1,4-benzoxazin-3-one (PubChem CID 82255594) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-ethyl-6-(2-piperazin-1-ylpropyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-ethyl-6-(2-piperazin-1-ylpropyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 82255594 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 4-ethyl-6-(2-piperazin-1-ylpropyl)-1,4-benzoxazin-3-one |
| SMILES | CCN1C(=O)COc2ccc(CC(C)N3CCNCC3)cc21 |
| InChI | InChI=1S/C17H25N3O2/c1-3-20-15-11-14(4-5-16(15)22-12-17(20)21)10-13(2)19-8-6-18-7-9-19/h4-5,11,13,18H,3,6-10,12H2,1-2H3 |
| InChIKey | QNWAXVWOKVVNNC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |